|
CAS#: 58905-05-8 Product: 1-[9-(2-Methylphenyl)Fluoren-9-Yl]Imidazole No suppilers available for the product. |
| Name | 1-[9-(2-Methylphenyl)Fluoren-9-Yl]Imidazole |
|---|---|
| Synonyms | 1-[9-(O-Tolyl)Fluoren-9-Yl]Imidazole; Phosphoric Acid; 1-[9-(O-Tolyl)-9-Fluorenyl]Imidazole; Phosphoric Acid; Bay-H 4364 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H24N2O8P2 |
| Molecular Weight | 518.40 |
| CAS Registry Number | 58905-05-8 |
| SMILES | O=[P](O)(O)O.O=[P](O)(O)O.C1=CC=CC3=C1C([N]2C=NC=C2)(C4=C3C=CC=C4)C5=CC=CC=C5C |
| InChI | 1S/C23H18N2.2H3O4P/c1-17-8-2-5-11-20(17)23(25-15-14-24-16-25)21-12-6-3-9-18(21)19-10-4-7-13-22(19)23;2*1-5(2,3)4/h2-16H,1H3;2*(H3,1,2,3,4) |
| InChIKey | YDSBPNPJEGIWEG-UHFFFAOYSA-N |
| Boiling point | 528.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 273.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[9-(2-Methylphenyl)Fluoren-9-Yl]Imidazole |