|
CAS#: 58948-14-4 Product: 2,2'-Oxybis[5,5-Bis(Bromomethyl)-1,3,2-Dioxaphosphorinane] 2,2'-Dioxide No suppilers available for the product. |
| Name | 2,2'-Oxybis[5,5-Bis(Bromomethyl)-1,3,2-Dioxaphosphorinane] 2,2'-Dioxide |
|---|---|
| Synonyms | 2-[[5,5-Bis(Bromomethyl)-2-Keto-1,3-Dioxa-2$L^{5}-Phosphacyclohex-2-Yl]Oxy]-5,5-Bis(Bromomethyl)-1,3-Dioxa-2$L^{5}-Phosphacyclohexane 2-Oxide; 2,2'-Oxybis(5,5-Bis(Bromomethyl)-1,3,2-Dioxaphosphorinane) 2,2'-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16Br4O7P2 |
| Molecular Weight | 629.80 |
| CAS Registry Number | 58948-14-4 |
| EINECS | 261-513-5 |
| SMILES | C(C2(CO[P](O[P]1(OCC(CO1)(CBr)CBr)=O)(OC2)=O)CBr)Br |
| InChI | 1S/C10H16Br4O7P2/c11-1-9(2-12)5-17-22(15,18-6-9)21-23(16)19-7-10(3-13,4-14)8-20-23/h1-8H2 |
| InChIKey | XKBRXFJIWDVQBE-UHFFFAOYSA-N |
| Density | 2.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.348°C at 760 mmHg (Cal.) |
| Flash point | 257.611°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Oxybis[5,5-Bis(Bromomethyl)-1,3,2-Dioxaphosphorinane] 2,2'-Dioxide |