|
CAS#: 58951-08-9 Product: 2,3-Dihydro-2,5-Dimethyl-1,4-Dithiin 1,1,4,4-Tetraoxide No suppilers available for the product. |
| Name | 2,3-Dihydro-2,5-Dimethyl-1,4-Dithiin 1,1,4,4-Tetraoxide |
|---|---|
| Synonyms | 2,3-Dihydro-2,5-Dimethyl-1,4-Dithiin 1,1,4,4-Tetraoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10O4S2 |
| Molecular Weight | 210.26 |
| CAS Registry Number | 58951-08-9 |
| EINECS | 261-518-2 |
| SMILES | CC1=C[S](=O)(=O)C(C[S]1(=O)=O)C |
| InChI | 1S/C6H10O4S2/c1-5-3-12(9,10)6(2)4-11(5,7)8/h3,6H,4H2,1-2H3 |
| InChIKey | WICDRHMSCYGNQI-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.169°C at 760 mmHg (Cal.) |
| Flash point | 335.414°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-2,5-Dimethyl-1,4-Dithiin 1,1,4,4-Tetraoxide |