Online Database of Chemicals from Around the World
|
CAS#: 59089-67-7 Product: 2',4'-Difluoro[1,1'-Biphenyl]-4-Yl Acetate No suppilers available for the product. |
| Name | 2',4'-Difluoro[1,1'-Biphenyl]-4-Yl Acetate |
|---|---|
| Synonyms | Acetic Acid [4-(2,4-Difluorophenyl)Phenyl] Ester; [4-(2,4-Difluorophenyl)Phenyl] Ethanoate; 2',4'-Difluoro(1,1'-Biphenyl)-4-Yl Acetate |
| Molecular Structure | ![CAS#: 59089-67-7, 2',4'-Difluoro[1,1'-Biphenyl]-4-Yl Acetate](/moreStructures/59089-67-7.gif) |
| Molecular Formula | C14H10F2O2 |
| Molecular Weight | 248.23 |
| CAS Registry Number | 59089-67-7 |
| EINECS | 261-598-9 |
| SMILES | C1=C(C=CC(=C1F)C2=CC=C(OC(=O)C)C=C2)F |
| InChI | 1S/C14H10F2O2/c1-9(17)18-12-5-2-10(3-6-12)13-7-4-11(15)8-14(13)16/h2-8H,1H3 |
| InChIKey | XJRFDJWJMQOWDU-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.163°C at 760 mmHg (Cal.) |
| Flash point | 142.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2',4'-Difluoro[1,1'-Biphenyl]-4-Yl Acetate |