|
CAS#: 59092-07-8 Product: 15-cis-Lycopene No suppilers available for the product. |
| Name | 15-cis-Lycopene |
|---|---|
| Synonyms | 15-Cis-Psi,Psi-Carotene; Psi,Psi-Carotene, 15-Cis- |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56 |
| Molecular Weight | 536.88 |
| CAS Registry Number | 59092-07-8 |
| SMILES | C(C=C(C)C)C\C(=C\C=C\C(=C\C=C\C(=C\C=C/C=C(/C=C/C=C(/C=C/C=C(/CCC=C(C)C)C)C)C)C)C)C |
| InChI | 1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11-,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+ |
| InChIKey | OAIJSZIZWZSQBC-XKKDEUFYSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 660.905°C at 760 mmHg (Cal.) |
| Flash point | 350.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 15-cis-Lycopene |