|
CAS#: 59230-81-8 Product: 12-Bromomethyl-7-Methylbenz[a]Anthracene No suppilers available for the product. |
| Name | 12-Bromomethyl-7-Methylbenz[a]Anthracene |
|---|---|
| Synonyms | 12-(Bromomethyl)-7-Methyl-Benzo[B]Phenanthrene; 12-Bromomethyl-7-Methylbenz(A)Anthracene; Benz(A)Anthracene, 12-Bromomethyl-7-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15Br |
| Molecular Weight | 335.24 |
| CAS Registry Number | 59230-81-8 |
| SMILES | C1=CC3=C(C2=CC=CC=C12)C(=C4C(=C3C)C=CC=C4)CBr |
| InChI | 1S/C20H15Br/c1-13-15-7-4-5-9-18(15)19(12-21)20-16(13)11-10-14-6-2-3-8-17(14)20/h2-11H,12H2,1H3 |
| InChIKey | CIJKQWCEYOGOJP-UHFFFAOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.96°C at 760 mmHg (Cal.) |
| Flash point | 258.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12-Bromomethyl-7-Methylbenz[a]Anthracene |