|
CAS#: 59333-90-3 Product: Exaprolol hydrochloride No suppilers available for the product. |
| Name | Exaprolol hydrochloride |
|---|---|
| Synonyms | 1-(2-Cyclohexylphenoxy)-3-(Isopropylamino)Propan-2-Ol Hydrochloride; Nsc297939; Vulm 111 Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H30ClNO2 |
| Molecular Weight | 327.89 |
| CAS Registry Number | 59333-90-3 |
| SMILES | [H+].C2=C(C1CCCCC1)C(=CC=C2)OCC(O)CNC(C)C.[Cl-] |
| InChI | 1S/C18H29NO2.ClH/c1-14(2)19-12-16(20)13-21-18-11-7-6-10-17(18)15-8-4-3-5-9-15;/h6-7,10-11,14-16,19-20H,3-5,8-9,12-13H2,1-2H3;1H |
| InChIKey | ODWXZMXQBDEIBF-UHFFFAOYSA-N |
| Boiling point | 445.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 223.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Exaprolol hydrochloride |