|
CAS#: 59410-25-2 Product: N-(Tert-Butyl)-2-Isopropyl-2,3-Dimethylbutyramide No suppilers available for the product. |
| Name | N-(Tert-Butyl)-2-Isopropyl-2,3-Dimethylbutyramide |
|---|---|
| Synonyms | N-Tert-Butyl-2-Isopropyl-2,3-Dimethyl-Butanamide; N-Tert-Butyl-2-Isopropyl-2,3-Dimethylbutanamide; N-Tert-Butyl-2-Isopropyl-2,3-Dimethyl-Butyramide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 |
| CAS Registry Number | 59410-25-2 |
| EINECS | 261-744-1 |
| SMILES | CC(C(NC(C)(C)C)=O)(C(C)C)C(C)C |
| InChI | 1S/C13H27NO/c1-9(2)13(8,10(3)4)11(15)14-12(5,6)7/h9-10H,1-8H3,(H,14,15) |
| InChIKey | HLBUUBQQEJBMOQ-UHFFFAOYSA-N |
| Density | 0.854g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.004°C at 760 mmHg (Cal.) |
| Flash point | 155.853°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Tert-Butyl)-2-Isopropyl-2,3-Dimethylbutyramide |