|
CAS#: 59485-08-4 Product: 2'-(4-Nitrophenoxy)Oxirane No suppilers available for the product. |
| Name | 2'-(4-Nitrophenoxy)Oxirane |
|---|---|
| Synonyms | Oxirane, (4-Nitrophenoxy)-; (4-Nitrophenoxy)Oxirane; 2'-(4-Nitrophenoxy)Oxirane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 |
| CAS Registry Number | 59485-08-4 |
| SMILES | C2=C(OC1OC1)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C8H7NO4/c10-9(11)6-1-3-7(4-2-6)13-8-5-12-8/h1-4,8H,5H2 |
| InChIKey | LCDJFVGAKJGCGB-UHFFFAOYSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.656°C at 760 mmHg (Cal.) |
| Flash point | 180.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-(4-Nitrophenoxy)Oxirane |