Online Database of Chemicals from Around the World
|
CAS#: 59536-15-1 Product: 4-[(Heptadecafluorononenyl)Oxy]Benzenesulphonyl Chloride No suppilers available for the product. |
| Name | 4-[(Heptadecafluorononenyl)Oxy]Benzenesulphonyl Chloride |
|---|---|
| Synonyms | 4-((Heptadecafluorononenyl)Oxy)Benzenesulphonyl Chloride |
| Molecular Structure | ![CAS#: 59536-15-1, 4-[(Heptadecafluorononenyl)Oxy]Benzenesulphonyl Chloride](/moreStructures/59536-15-1.gif) |
| Molecular Formula | C15H4ClF17O3S |
| Molecular Weight | 622.68 |
| CAS Registry Number | 59536-15-1 |
| EINECS | 261-798-6 |
| SMILES | C1=C([S](Cl)(=O)=O)C=CC(=C1)O\C(F)=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C15H4ClF17O3S/c16-37(34,35)6-3-1-5(2-4-6)36-8(18)7(17)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(31,32)33/h1-4H/b8-7- |
| InChIKey | PPJLYJGIFDYVNT-FPLPWBNLSA-N |
| Density | 1.691g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.872°C at 760 mmHg (Cal.) |
| Flash point | 164.188°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(Heptadecafluorononenyl)Oxy]Benzenesulphonyl Chloride |