|
CAS#: 5956-39-8 Product: Epipolygodial No suppilers available for the product. |
| Name | Epipolygodial |
|---|---|
| Synonyms | (8Ar)-5,5,8A-Trimethyl-3,4,4A,6,7,8-Hexahydronaphthalene-1,2-Dicarboxaldehyde; 1,2-Naphthalenedicarboxaldehyde, 1,4,4A,5,6,7,8,8A-Octahydro-5,5,8A-Trimethyl-, (1S,4As,8As)-; 1,2-Naphthalenedicarboxaldehyde, 1,4,4A,5,6,7,8,8A-Octahydro-5,5,8A-Trimethyl-, (1S-(1Alpha,4Aalpha,8Abeta))- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 5956-39-8 |
| SMILES | [C@@]12(C(C(CCC1)(C)C)CCC(=C2C=O)C=O)C |
| InChI | 1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h9-10,13H,4-8H2,1-3H3/t13?,15-/m0/s1 |
| InChIKey | AJDMJBJWEHIWMK-WUJWULDRSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.743°C at 760 mmHg (Cal.) |
| Flash point | 123.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Epipolygodial |