|
CAS#: 59574-26-4 Product: 2-Methylarginine No suppilers available for the product. |
| Name | 2-Methylarginine |
|---|---|
| Synonyms | (2S)-2-Amino-5-Guanidino-2-Methyl-Pentanoic Acid; (2S)-2-Amino-5-Guanidino-2-Methylpentanoic Acid; (2S)-2-Amino-5-Guanidino-2-Methyl-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 |
| CAS Registry Number | 59574-26-4 |
| SMILES | [C@](N)(CCCN=C(N)N)(C)C(O)=O |
| InChI | 1S/C7H16N4O2/c1-7(10,5(12)13)3-2-4-11-6(8)9/h2-4,10H2,1H3,(H,12,13)(H4,8,9,11)/t7-/m0/s1 |
| InChIKey | LKRMSSDDHQZQHJ-ZETCQYMHSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.449°C at 760 mmHg (Cal.) |
| Flash point | 199.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylarginine |