|
CAS#: 59591-73-0 Product: 1H-Indazole-3-Ylphenyl Methanone No suppilers available for the product. |
| Name | 1H-Indazole-3-Ylphenyl Methanone |
|---|---|
| Synonyms | 1H-Indazol-3-Yl-Phenyl-Methanone; Nsc126427 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 |
| CAS Registry Number | 59591-73-0 |
| SMILES | C1=CC=CC2=C1[NH]N=C2C(C3=CC=CC=C3)=O |
| InChI | 1S/C14H10N2O/c17-14(10-6-2-1-3-7-10)13-11-8-4-5-9-12(11)15-16-13/h1-9H,(H,15,16) |
| InChIKey | TYXYQGQGUVYKLU-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.903°C at 760 mmHg (Cal.) |
| Flash point | 216.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Indazole-3-Ylphenyl Methanone |