|
CAS#: 596-56-5 Product: 1-Phenyl-1,2,3,4-Tetrahydro-1,4-Naphthalenedicarboxylic Acid No suppilers available for the product. |
| Name | 1-Phenyl-1,2,3,4-Tetrahydro-1,4-Naphthalenedicarboxylic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 596-56-5 |
| SMILES | O=C(O)C2(c1c(cccc1)C(C(=O)O)CC2)c3ccccc3 |
| InChI | 1S/C18H16O4/c19-16(20)14-10-11-18(17(21)22,12-6-2-1-3-7-12)15-9-5-4-8-13(14)15/h1-9,14H,10-11H2,(H,19,20)(H,21,22) |
| InChIKey | LRUSLZFPYBAMCI-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.055°C at 760 mmHg (Cal.) |
| Flash point | 239.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-1,2,3,4-Tetrahydro-1,4-Naphthalenedicarboxylic Acid |