|
CAS#: 5972-71-4 Product: Ammonium Hydrogen Malate No suppilers available for the product. |
| Name | Ammonium Hydrogen Malate |
|---|---|
| Synonyms | Ammonium 3,4-Dihydroxy-4-Oxo-Butanoate; Ammonium 3,4-Dihydroxy-4-Oxobutanoate; Ammonium 3,4-Dihydroxy-4-Keto-Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9NO5 |
| Molecular Weight | 151.12 |
| CAS Registry Number | 5972-71-4 |
| EINECS | 227-762-9 |
| SMILES | C(C(O)C(O)=O)C([O-])=O.[NH4+] |
| InChI | 1S/C4H6O5.H3N/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);1H3 |
| InChIKey | RMIOHTPMSWCRSO-UHFFFAOYSA-N |
| Boiling point | 306.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 153.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Hydrogen Malate |