|
CAS#: 59742-87-9 Product: 4-Amino-6-Tert-Butyl-3,4-Dihydro-3-Mercapto-1,2,4-Triazin-5(2H)-One No suppilers available for the product. |
| Name | 4-Amino-6-Tert-Butyl-3,4-Dihydro-3-Mercapto-1,2,4-Triazin-5(2H)-One |
|---|---|
| Synonyms | 4-Amino-6-Tert-Butyl-3-Mercapto-2,3-Dihydro-1,2,4-Triazin-5-One; 4-Amino-6-Tert-Butyl-3,4-Dihydro-3-Mercapto-1,2,4-Triazin-5(2H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.27 |
| CAS Registry Number | 59742-87-9 |
| EINECS | 261-906-1 |
| SMILES | CC(C1=NNC(N(C1=O)N)S)(C)C |
| InChI | 1S/C7H14N4OS/c1-7(2,3)4-5(12)11(8)6(13)10-9-4/h6,10,13H,8H2,1-3H3 |
| InChIKey | UEEQZFBEGRGQGN-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.849°C at 760 mmHg (Cal.) |
| Flash point | 141.797°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-6-Tert-Butyl-3,4-Dihydro-3-Mercapto-1,2,4-Triazin-5(2H)-One |