|
CAS#: 5977-35-5 Product: 3-[N,N'-Bis(2-chloroethyl)amino]-4-methylbenzoic acid No suppilers available for the product. |
| Name | 3-[N,N'-Bis(2-chloroethyl)amino]-4-methylbenzoic acid |
|---|---|
| Synonyms | Sodium 3-[Bis(2-Chloroethyl)Amino]-4-Methyl-Benzoate; 3-(Bis(2-Chloroethyl)Amino)-P-Toluic Acid Sodium Salt; 3-(Di-(2-Chloroethyl))Amino-4-Methylbenzoic Acid Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14Cl2NNaO2 |
| Molecular Weight | 298.14 |
| CAS Registry Number | 5977-35-5 (52616-25-8) |
| SMILES | C1=C(C=CC(=C1N(CCCl)CCCl)C)C([O-])=O.[Na+] |
| InChI | 1S/C12H15Cl2NO2.Na/c1-9-2-3-10(12(16)17)8-11(9)15(6-4-13)7-5-14;/h2-3,8H,4-7H2,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | CRWUUOBIPYBVKP-UHFFFAOYSA-M |
| Boiling point | 440.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 220.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[N,N'-Bis(2-chloroethyl)amino]-4-methylbenzoic acid |