|
CAS#: 5977-36-6 Product: 5-[Bis(2-chloroethyl)amino]-2-methyl-Benzoic acid No suppilers available for the product. |
| Name | 5-[Bis(2-chloroethyl)amino]-2-methyl-Benzoic acid |
|---|---|
| Synonyms | 5-[Bis(2-Chloroethyl)Amino]-2-Methyl-Benzoic Acid; 5-Bis(2-Chloroethyl)Amino-2-Methylbenzoic Acid; 5-Bis(2-Chloroethyl)Amino-O-Toluic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 |
| CAS Registry Number | 5977-36-6 |
| SMILES | C1=CC(=CC(=C1C)C(O)=O)N(CCCl)CCCl |
| InChI | 1S/C12H15Cl2NO2/c1-9-2-3-10(8-11(9)12(16)17)15(6-4-13)7-5-14/h2-3,8H,4-7H2,1H3,(H,16,17) |
| InChIKey | CGKKAGUCZCKFJI-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.116°C at 760 mmHg (Cal.) |
| Flash point | 229.651°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[Bis(2-chloroethyl)amino]-2-methyl-Benzoic acid |