|
CAS#: 5982-87-6 Product: Ethylbis(3-Phenylpropyl)Ammonium Chloride No suppilers available for the product. |
| Name | Ethylbis(3-Phenylpropyl)Ammonium Chloride |
|---|---|
| Synonyms | Ethyl-Bis(3-Phenylpropyl)Amine Hydrochloride; Ethylbis(3-Phenylpropyl)Ammonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28ClN |
| Molecular Weight | 317.90 |
| CAS Registry Number | 5982-87-6 |
| EINECS | 227-793-8 |
| SMILES | [H+].C2=C(CCCN(CCCC1=CC=CC=C1)CC)C=CC=C2.[Cl-] |
| InChI | 1S/C20H27N.ClH/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;/h3-8,11-14H,2,9-10,15-18H2,1H3;1H |
| InChIKey | ZKRKHXXSBDSIKQ-UHFFFAOYSA-N |
| Boiling point | 358.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylbis(3-Phenylpropyl)Ammonium Chloride |