|
CAS#: 60159-97-9 Product: Diethylamine Phosphate No suppilers available for the product. |
| Name | Diethylamine Phosphate |
|---|---|
| Synonyms | Diethylamine Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H11NO4P |
| Molecular Weight | 168.11 |
| CAS Registry Number | 60159-97-9 |
| EINECS | 262-088-9 |
| SMILES | O=[P]([O-])([O-])[O-].C(NCC)C |
| InChI | 1S/C4H11N.H3O4P/c1-3-5-4-2;1-5(2,3)4/h5H,3-4H2,1-2H3;(H3,1,2,3,4)/p-3 |
| InChIKey | ASLNLSYDVOWAFS-UHFFFAOYSA-K |
| Boiling point | 57.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylamine Phosphate |