|
CAS#: 60207-92-3 Product: 2-(Bromomethyl)-2-(2,4-Dichlorophenyl)-4-Ethyl-1,3-Dioxolane No suppilers available for the product. |
| Name | 2-(Bromomethyl)-2-(2,4-Dichlorophenyl)-4-Ethyl-1,3-Dioxolane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H13BrCl2O2 |
| Molecular Weight | 340.04 |
| CAS Registry Number | 60207-92-3 |
| EINECS | 262-106-5 |
| SMILES | C1=CC(=CC(=C1C2(OC(CO2)CC)CBr)Cl)Cl |
| InChI | 1S/C12H13BrCl2O2/c1-2-9-6-16-12(7-13,17-9)10-4-3-8(14)5-11(10)15/h3-5,9H,2,6-7H2,1H3 |
| InChIKey | WVOHJAWNRZYVCS-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.334°C at 760 mmHg (Cal.) |
| Flash point | 186.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Bromomethyl)-2-(2,4-Dichlorophenyl)-4-Ethyl-1,3-Dioxolane |