|
CAS#: 60316-43-0 Product: 1,8-Bis(Methylamino)Anthraquinone No suppilers available for the product. |
| Name | 1,8-Bis(Methylamino)Anthraquinone |
|---|---|
| Synonyms | 1,8-Bis(Methylamino)-9,10-Anthraquinone; 1,8-Bis(Methylamino)-9,10-Anthracenedione; 1,8-Bis(Methylamino)Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 60316-43-0 |
| EINECS | 262-167-8 |
| SMILES | C1=C(NC)C2=C(C=C1)C(=O)C3=C(C2=O)C(=CC=C3)NC |
| InChI | 1S/C16H14N2O2/c1-17-11-7-3-5-9-13(11)16(20)14-10(15(9)19)6-4-8-12(14)18-2/h3-8,17-18H,1-2H3 |
| InChIKey | WBNXSOGPMIRTPK-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.953°C at 760 mmHg (Cal.) |
| Flash point | 213.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Bis(Methylamino)Anthraquinone |