Online Database of Chemicals from Around the World
| Name | Ethyl 3-Amino-5-(Trifluoromethyl)-1H-Indazole-1-Carboxylate |
|---|---|
| Synonyms | 3-Amino-5-(Trifluoromethyl)-1-Indazolecarboxylic Acid Ethyl Ester; 3-Amino-5-(Trifluoromethyl)Indazole-1-Carboxylic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 |
| CAS Registry Number | 60330-12-3 |
| EINECS | 262-185-6 |
| SMILES | C1=C(C(F)(F)F)C=CC2=C1C(=N[N]2C(OCC)=O)N |
| InChI | 1S/C11H10F3N3O2/c1-2-19-10(18)17-8-4-3-6(11(12,13)14)5-7(8)9(15)16-17/h3-5H,2H2,1H3,(H2,15,16) |
| InChIKey | UGXOEWBGAICBHP-UHFFFAOYSA-N |
| Density | 1.501g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.421°C at 760 mmHg (Cal.) |
| Flash point | 191.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-Amino-5-(Trifluoromethyl)-1H-Indazole-1-Carboxylate |
