|
CAS#: 60439-52-3 Product: 3,5-Dichloro-N-cyclopropyl-4-(methylamino)benzamide No suppilers available for the product. |
| Name | 3,5-Dichloro-N-cyclopropyl-4-(methylamino)benzamide |
|---|---|
| Synonyms | 3,5-Dichloro-N-Cyclopropyl-4-Methylamino-Benzamide; A 22700; Abbott-22700 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.13 |
| CAS Registry Number | 60439-52-3 |
| SMILES | C1=C(C(=C(C=C1C(NC2CC2)=O)Cl)NC)Cl |
| InChI | 1S/C11H12Cl2N2O/c1-14-10-8(12)4-6(5-9(10)13)11(16)15-7-2-3-7/h4-5,7,14H,2-3H2,1H3,(H,15,16) |
| InChIKey | YYVJXCMEJLMKHX-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.122°C at 760 mmHg (Cal.) |
| Flash point | 175.225°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-N-cyclopropyl-4-(methylamino)benzamide |