|
CAS#: 60451-07-2 Product: Neodecanoic Acid, Vanadium Salt No suppilers available for the product. |
| Name | Neodecanoic Acid, Vanadium Salt |
|---|---|
| Synonyms | Neodecanoic Acid, Vanadium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 |
| CAS Registry Number | 60451-07-2 |
| EINECS | 262-238-3 |
| SMILES | C(C(CC(O)=O)(C)C)C(C)(C)C.C |
| InChI | 1S/C10H20O2.CH4/c1-9(2,3)7-10(4,5)6-8(11)12;/h6-7H2,1-5H3,(H,11,12);1H4 |
| InChIKey | YLVKKEJSTXIAMO-UHFFFAOYSA-N |
| Boiling point | 256.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Neodecanoic Acid, Vanadium Salt |