|
CAS#: 6045-67-6 Product: Estradiol 17-Acetate No suppilers available for the product. |
| Name | Estradiol 17-Acetate |
|---|---|
| Synonyms | Acetic Acid [(8R,9S,13S,14S)-3-Hydroxy-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthren-17-Yl] Ester; [(8R,9S,13S,14S)-3-Hydroxy-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthren-17-Yl] Ethanoate; Estra-1,3,5(10)-Triene-3,17-Diol, 17-Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 |
| CAS Registry Number | 6045-67-6 |
| SMILES | [C@H]12[C@@](C(OC(C)=O)CC1)(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)O)C |
| InChI | 1S/C20H26O3/c1-12(21)23-19-8-7-18-17-5-3-13-11-14(22)4-6-15(13)16(17)9-10-20(18,19)2/h4,6,11,16-19,22H,3,5,7-10H2,1-2H3/t16-,17-,18+,19?,20+/m1/s1 |
| InChIKey | QAHOQNJVHDHYRN-QDSUGMFFSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.469°C at 760 mmHg (Cal.) |
| Flash point | 181.875°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Estradiol 17-Acetate |