|
CAS#: 60462-51-3 Product: N-[4-(2-Phenylethenyl)phenyl]hydroxylamine No suppilers available for the product. |
| Name | N-[4-(2-Phenylethenyl)phenyl]hydroxylamine |
|---|---|
| Synonyms | N-[4-(2-Phenylethenyl)Phenyl]Hydroxylamine; N-[4-[(E)-2-Phenylvinyl]Phenyl]Hydroxylamine; N-[4-(2-Phenylvinyl)Phenyl]Hydroxylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| CAS Registry Number | 60462-51-3 |
| SMILES | C2=C(\C=C\C1=CC=CC=C1)C=CC(=C2)NO |
| InChI | 1S/C14H13NO/c16-15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-11,15-16H/b7-6+ |
| InChIKey | NERSJRGIHYMPEP-VOTSOKGWSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.806°C at 760 mmHg (Cal.) |
| Flash point | 152.917°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(2-Phenylethenyl)phenyl]hydroxylamine |