|
CAS#: 60452-46-2 Product: 2-(Dimethylamino)Ethyl (+)-(1-Hydroxycyclopentyl)Phenylacetate Hydrochloride No suppilers available for the product. |
| Name | 2-(Dimethylamino)Ethyl (+)-(1-Hydroxycyclopentyl)Phenylacetate Hydrochloride |
|---|---|
| Synonyms | (2-Dimethylamino-2-Ethyl-1-Hydroxy-Cyclopentyl) 2-Phenylacetate Hydrochloride; 2-Phenylacetic Acid (2-Dimethylamino-2-Ethyl-1-Hydroxycyclopentyl) Ester Hydrochloride; 2-Phenylacetic Acid (2-Dimethylamino-2-Ethyl-1-Hydroxy-Cyclopentyl) Ester Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 |
| CAS Registry Number | 60452-46-2 |
| EINECS | 262-242-5 |
| SMILES | [H+].C2=C(CC(OC1(O)C(N(C)C)(CCC1)CC)=O)C=CC=C2.[Cl-] |
| InChI | 1S/C17H25NO3.ClH/c1-4-16(18(2)3)11-8-12-17(16,20)21-15(19)13-14-9-6-5-7-10-14;/h5-7,9-10,20H,4,8,11-13H2,1-3H3;1H |
| InChIKey | DFXXFIMZTUONPS-UHFFFAOYSA-N |
| Boiling point | 397.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 194.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)Ethyl (+)-(1-Hydroxycyclopentyl)Phenylacetate Hydrochloride |