|
CAS#: 60498-89-7 Product: Gnididione No suppilers available for the product. |
| Name | Gnididione |
|---|---|
| Synonyms | 3,6,9-Trimethyl-5,6,6A,7-Tetrahydroazuleno[4,5-B]Furan-4,8-Quinone; Azuleno(4,5-B)Furan-4,8-Dione, 5,6,6A,7-Tetrahydro-3,6,9-Trimethyl-, Cis-(+)-; Gnididione |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| CAS Registry Number | 60498-89-7 |
| SMILES | C1=C(C3=C(O1)C2=C(C(=O)CC2C(CC3=O)C)C)C |
| InChI | 1S/C15H16O3/c1-7-4-12(17)13-8(2)6-18-15(13)14-9(3)11(16)5-10(7)14/h6-7,10H,4-5H2,1-3H3 |
| InChIKey | CLAPLFAABVVYOH-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.251°C at 760 mmHg (Cal.) |
| Flash point | 188.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Gnididione |