|
CAS#: 60506-83-4 Product: 4,6-Dichloro-1-Nitroanthraquinone No suppilers available for the product. |
| Name | 4,6-Dichloro-1-Nitroanthraquinone |
|---|---|
| Synonyms | 4,6-Dichloro-1-Nitro-Anthracene-9,10-Dione; 4,6-Dichloro-1-Nitro-9,10-Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H5Cl2NO4 |
| Molecular Weight | 322.10 |
| CAS Registry Number | 60506-83-4 |
| EINECS | 262-271-3 |
| SMILES | C1=C(Cl)C=CC3=C1C(=O)C2=C(Cl)C=CC(=C2C3=O)[N+]([O-])=O |
| InChI | 1S/C14H5Cl2NO4/c15-6-1-2-7-8(5-6)14(19)11-9(16)3-4-10(17(20)21)12(11)13(7)18/h1-5H |
| InChIKey | UFYUVEYNCNGOHW-UHFFFAOYSA-N |
| Density | 1.653g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.144°C at 760 mmHg (Cal.) |
| Flash point | 277.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dichloro-1-Nitroanthraquinone |