Online Database of Chemicals from Around the World
|
CAS#: 60548-28-9 Product: 4-Chloro-N-Cyclopropyl-alpha,beta-Dimethylcinnamamide No suppilers available for the product. |
| Name | 4-Chloro-N-Cyclopropyl-alpha,beta-Dimethylcinnamamide |
|---|---|
| Synonyms | 3-(4-Chlorophenyl)-N-Cyclopropyl-2-Methylbut-2-Enamide; (E)-3-(4-Chlorophenyl)-N-Cyclopropyl-2-Methyl-But-2-Enamide; 3-(4-Chlorophenyl)-N-Cyclopropyl-2-Methyl-But-2-Enamide |
| Molecular Structure |  |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 |
| CAS Registry Number | 60548-28-9 |
| SMILES | C2=C(C(=C(C(=O)NC1CC1)\C)/C)C=CC(=C2)Cl |
| InChI | 1S/C14H16ClNO/c1-9(11-3-5-12(15)6-4-11)10(2)14(17)16-13-7-8-13/h3-6,13H,7-8H2,1-2H3,(H,16,17)/b10-9+ |
| InChIKey | SDHSWSFAQOTVMR-MDZDMXLPSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.49°C at 760 mmHg (Cal.) |
| Flash point | 208.71°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-N-Cyclopropyl-alpha,beta-Dimethylcinnamamide |