|
CAS#: 60550-85-8 Product: N-(9H-Fluoren-2-Yl)Carbamic Acid Methyl Ester No suppilers available for the product. |
| Name | N-(9H-Fluoren-2-Yl)Carbamic Acid Methyl Ester |
|---|---|
| Synonyms | N-(9H-Fluoren-2-Yl)Carbamic Acid Methyl Ester; 2-Fluorenecarbamic Acid, Methyl Ester; 3-12-00-03288 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 |
| CAS Registry Number | 60550-85-8 |
| SMILES | C3=C2C1=CC=CC=C1CC2=CC(=C3)NC(OC)=O |
| InChI | 1S/C15H13NO2/c1-18-15(17)16-12-6-7-14-11(9-12)8-10-4-2-3-5-13(10)14/h2-7,9H,8H2,1H3,(H,16,17) |
| InChIKey | KMSUWWHYYOFHDI-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.639°C at 760 mmHg (Cal.) |
| Flash point | 171.908°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(9H-Fluoren-2-Yl)Carbamic Acid Methyl Ester |