|
CAS#: 60607-35-4 Product: Topterone No suppilers available for the product. |
| Name | Topterone |
|---|---|
| Synonyms | (17Beta)-17-Hydroxy-17-Propylandrost-4-En-3-One; 17Beta-Hydroxy-17-Propylandrost-4-En-3-One; Androst-4-En-3-One, 17-Hydroxy-17-Propyl-, (17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 |
| CAS Registry Number | 60607-35-4 |
| EINECS | 262-321-4 |
| SMILES | [C@H]12C([C@@](O)(CC1)CCC)(CC[C@H]3C2CCC4=CC(=O)CCC34C)C |
| InChI | 1S/C22H34O2/c1-4-10-22(24)13-9-19-17-6-5-15-14-16(23)7-11-20(15,2)18(17)8-12-21(19,22)3/h14,17-19,24H,4-13H2,1-3H3/t17?,18-,19-,20?,21?,22-/m0/s1 |
| InChIKey | LZSOOHLAZHOTHJ-WSJORCQWSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.818°C at 760 mmHg (Cal.) |
| Flash point | 195.723°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Topterone |