|
CAS#: 60643-20-1 Product: 1-L-Alanyl-D-Proline No suppilers available for the product. |
| Name | 1-L-Alanyl-D-Proline |
|---|---|
| Synonyms | (2R)-1-[(2S)-2-Amino-1-Oxopropyl]-2-Pyrrolidinecarboxylic Acid; (2R)-1-Alanylproline; 1-L-Alanyl-D-Proline |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 60643-20-1 |
| EINECS | 262-343-4 |
| SMILES | [C@H]1(N(C(=O)[C@@H](N)C)CCC1)C(O)=O |
| InChI | 1S/C8H14N2O3/c1-5(9)7(11)10-4-2-3-6(10)8(12)13/h5-6H,2-4,9H2,1H3,(H,12,13)/t5-,6+/m0/s1 |
| InChIKey | WPWUFUBLGADILS-NTSWFWBYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.75°C at 760 mmHg (Cal.) |
| Flash point | 197.981°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-L-Alanyl-D-Proline |