|
CAS#: 6064-84-2 Product: 2-Nitrophenyl phosphate No suppilers available for the product. |
| Name | 2-Nitrophenyl phosphate |
|---|---|
| Synonyms | Phosphoric Acid, Mono(2-Nitrophenyl) Ester; Mono(2-Nitrophenyl) Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4NO6P |
| Molecular Weight | 217.07 |
| CAS Registry Number | 6064-84-2 |
| SMILES | C1=CC=CC(=C1O[P]([O-])([O-])=O)[N+]([O-])=O |
| InChI | 1S/C6H6NO6P/c8-7(9)5-3-1-2-4-6(5)13-14(10,11)12/h1-4H,(H2,10,11,12)/p-2 |
| InChIKey | BUBWKNKRFRMZNS-UHFFFAOYSA-L |
| Boiling point | 446.857°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 224.051°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitrophenyl phosphate |