|
CAS#: 60700-37-0 Product: Acrylic Acid, Nickel (II) Salt No suppilers available for the product. |
| Name | Acrylic Acid, Nickel (II) Salt |
|---|---|
| Synonyms | Nickelous Prop-2-Enoate; Nickelous Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6NiO4 |
| Molecular Weight | 200.80 |
| CAS Registry Number | 60700-37-0 |
| EINECS | 262-383-2 |
| SMILES | O=C([O-])C=C.O=C([O-])C=C.[Ni++] |
| InChI | 1S/2C3H4O2.Ni/c2*1-2-3(4)5;/h2*2H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | QFVGCVZHAQQIMT-UHFFFAOYSA-L |
| Boiling point | 141°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 61.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acrylic Acid, Nickel (II) Salt |