|
CAS#: 60706-49-2 Product: 9-(1-Methyl-2-Piperidylmethyl)-9H-Carbazole No suppilers available for the product. |
| Name | 9-(1-Methyl-2-Piperidylmethyl)-9H-Carbazole |
|---|---|
| Synonyms | 9-[(1-Methyl-2-Piperidyl)Methyl]Carbazole; 9-[(1-Methyl-2-Piperidinyl)Methyl]Carbazole; 9-(1-Methyl-Piperidyl-(2)-Methyl)-Carbazol [German] |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 |
| CAS Registry Number | 60706-49-2 |
| SMILES | C1=CC=CC2=C1[N](C3=C2C=CC=C3)CC4N(CCCC4)C |
| InChI | 1S/C19H22N2/c1-20-13-7-6-8-15(20)14-21-18-11-4-2-9-16(18)17-10-3-5-12-19(17)21/h2-5,9-12,15H,6-8,13-14H2,1H3 |
| InChIKey | JVFDOOGBFMRGJE-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.017°C at 760 mmHg (Cal.) |
| Flash point | 218.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(1-Methyl-2-Piperidylmethyl)-9H-Carbazole |