|
CAS#: 60712-44-9 Product: 3,4,6-Trichloroguaiacol No suppilers available for the product. |
| Name | 3,4,6-Trichloroguaiacol |
|---|---|
| Synonyms | 3,4,6-Trichloro-2-Methoxy-Phenol; 3,4,6-Trichloro-Guaiacol; 3,4,6-Tcg |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5Cl3O2 |
| Molecular Weight | 227.47 |
| CAS Registry Number | 60712-44-9 |
| SMILES | C1=C(Cl)C(=C(OC)C(=C1Cl)O)Cl |
| InChI | 1S/C7H5Cl3O2/c1-12-7-5(10)3(8)2-4(9)6(7)11/h2,11H,1H3 |
| InChIKey | HYCQPRXDNCTPOU-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.544°C at 760 mmHg (Cal.) |
| Flash point | 125.283°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,6-Trichloroguaiacol |