|
CAS#: 60719-87-1 Product: 8-Phenyl-1,4,6-Triazabicyclo[3.3.0]Oct-5-Ene No suppilers available for the product. |
| Name | 8-Phenyl-1,4,6-Triazabicyclo[3.3.0]Oct-5-Ene |
|---|---|
| Synonyms | D00974; Deximafen; Deximafen (Usan/Inn) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.24 |
| CAS Registry Number | 60719-87-1 |
| SMILES | C3=C(C1N2C(=NC1)NCC2)C=CC=C3 |
| InChI | 1S/C11H13N3/c1-2-4-9(5-3-1)10-8-13-11-12-6-7-14(10)11/h1-5,10H,6-8H2,(H,12,13) |
| InChIKey | VVLJQSJNPKNTAT-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.494°C at 760 mmHg (Cal.) |
| Flash point | 144.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Phenyl-1,4,6-Triazabicyclo[3.3.0]Oct-5-Ene |