|
CAS#: 60846-14-2 Product: Ethyl (2Z)-2-Methoxyimino-3-Oxo-Butanoate No suppilers available for the product. |
| Name | Ethyl (2Z)-2-Methoxyimino-3-Oxo-Butanoate |
|---|---|
| Synonyms | Ethyl (2E)-2-Methoxyimino-3-Oxo-Butanoate; (2E)-2-Methoxyimino-3-Oxobutanoic Acid Ethyl Ester; (2E)-3-Keto-2-Methoxyimino-Butyric Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 |
| CAS Registry Number | 60846-14-2 |
| SMILES | C(OC(=O)/C(=N/OC)C(=O)C)C |
| InChI | 1S/C7H11NO4/c1-4-12-7(10)6(5(2)9)8-11-3/h4H2,1-3H3/b8-6+ |
| InChIKey | HASOOENYFDJEAK-SOFGYWHQSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.039°C at 760 mmHg (Cal.) |
| Flash point | 85.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2Z)-2-Methoxyimino-3-Oxo-Butanoate |