|
CAS#: 60890-27-9 Product: 1-(3,4-Dimethoxyphenyl)-2-pyrrolidin-2-ylethanone No suppilers available for the product. |
| Name | 1-(3,4-Dimethoxyphenyl)-2-pyrrolidin-2-ylethanone |
|---|---|
| Synonyms | 1-(3,4-Dimethoxyphenyl)-2-Pyrrolidin-2-Yl-Ethanone; 1-(3,4-Dimethoxyphenyl)-2-(2-Pyrrolidinyl)Ethanone; C10169 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 |
| CAS Registry Number | 60890-27-9 |
| SMILES | C1=C(OC)C(=CC=C1C(CC2NCCC2)=O)OC |
| InChI | 1S/C14H19NO3/c1-17-13-6-5-10(8-14(13)18-2)12(16)9-11-4-3-7-15-11/h5-6,8,11,15H,3-4,7,9H2,1-2H3 |
| InChIKey | TYXKSMFICLVQCO-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.415°C at 760 mmHg (Cal.) |
| Flash point | 188.707°C (Cal.) |
| (1) | BROWN D, CHARREAU P, HANSSON T, LEY S. Substitution reactions of 2-phenylsulphonyl-piperidines and -pyrrolidines with carbon nucleophiles: Synthesis of the pyrrolidine alkaloids norruspoline and ruspolinone, Tetrahedron, 1991 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dimethoxyphenyl)-2-pyrrolidin-2-ylethanone |