|
CAS#: 608-94-6 Product: 2,3,6-Trichlorohydroquinone No suppilers available for the product. |
| Name | 2,3,6-Trichlorohydroquinone |
|---|---|
| Synonyms | 2,3,5-Trichlorohydroquinone; Trch; C0328 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Cl3O2 |
| Molecular Weight | 213.45 |
| CAS Registry Number | 608-94-6 |
| SMILES | C1=C(O)C(=C(Cl)C(=C1Cl)O)Cl |
| InChI | 1S/C6H3Cl3O2/c7-2-1-3(10)4(8)5(9)6(2)11/h1,10-11H |
| InChIKey | ZIIRLFNUZROIBX-UHFFFAOYSA-N |
| Density | 1.748g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.176°C at 760 mmHg (Cal.) |
| Flash point | 123.851°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Trichlorohydroquinone |