| Name | 2-[(Chloroacetyl)Oxy]Benzoic Acid |
|---|---|
| Synonyms | 2-(2-Chloro-1-Oxoethoxy)Benzoic Acid; 2-(2-Chloroethanoyloxy)Benzoic Acid; Acetic Acid, Chloro-, Ester With Salicylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7ClO4 |
| Molecular Weight | 214.60 |
| CAS Registry Number | 6090-79-5 |
| SMILES | C1=CC=CC(=C1C(=O)O)OC(=O)CCl |
| InChI | 1S/C9H7ClO4/c10-5-8(11)14-7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,12,13) |
| InChIKey | LAZUHOPLTJOKNS-UHFFFAOYSA-N |
| Density | 1.421g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.089°C at 760 mmHg (Cal.) |
| Flash point | 170.367°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(Chloroacetyl)Oxy]Benzoic Acid |