|
CAS#: 6093-67-0 Product: 5-Hydroxycoumarin No suppilers available for the product. |
| Name | 5-Hydroxycoumarin |
|---|---|
| Synonyms | 5-Hydroxy-2-Chromenone; 5-Hydroxycoumarin; Coumarin, 5-Hydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6O3 |
| Molecular Weight | 162.14 |
| CAS Registry Number | 6093-67-0 |
| SMILES | C1=CC=C(C2=C1OC(C=C2)=O)O |
| InChI | 1S/C9H6O3/c10-7-2-1-3-8-6(7)4-5-9(11)12-8/h1-5,10H |
| InChIKey | CDHSCTCRBLLCBJ-UHFFFAOYSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.672°C at 760 mmHg (Cal.) |
| Flash point | 168.723°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxycoumarin |