|
CAS#: 60973-95-7 Product: 2-Bromoacetamidoestrone Methyl Ether No suppilers available for the product. |
| Name | 2-Bromoacetamidoestrone Methyl Ether |
|---|---|
| Synonyms | 2-Bromo-N-[(13S)-17-Keto-3-Methoxy-13-Methyl-7,8,9,11,12,14,15,16-Octahydro-6H-Cyclopenta[A]Phenanthren-2-Yl]Acetamide; 2-Bromo-N-[(13S)-3-Methoxy-13-Methyl-17-Oxo-7,8,9,11,12,14,15,16-Octahydro-6H-Cyclopenta[A]Phenanthren-2-Yl]Ethanamide; 2-Bromo-N-(3-Methoxy-17-Oxoestra-1,3,5(10)-Trien-2-Yl)Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 |
| CAS Registry Number | 60973-95-7 |
| SMILES | [C@]34(C(C2CCC1=C(C=C(NC(CBr)=O)C(=C1)OC)C2CC3)CCC4=O)C |
| InChI | 1S/C21H26BrNO3/c1-21-8-7-13-14(16(21)5-6-19(21)24)4-3-12-9-18(26-2)17(10-15(12)13)23-20(25)11-22/h9-10,13-14,16H,3-8,11H2,1-2H3,(H,23,25)/t13?,14?,16?,21-/m0/s1 |
| InChIKey | VNGDGEGSZSVNCN-AKLDVZJWSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.235°C at 760 mmHg (Cal.) |
| Flash point | 284.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromoacetamidoestrone Methyl Ether |