|
CAS#: 60986-89-2 Product: Clofurac No suppilers available for the product. |
| Name | Clofurac |
|---|---|
| Synonyms | 5-Chloro-6-Cyclohexyl-3H-Benzofuran-2-One; 2(3H)-Benzofuranone, 5-Chloro-6-Cyclohexyl-; 5-Chloro-6-Cyclohexyl-2(3H)-Benzofuranone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.72 |
| CAS Registry Number | 60986-89-2 |
| SMILES | C2=C(C1CCCCC1)C(=CC3=C2OC(=O)C3)Cl |
| InChI | 1S/C14H15ClO2/c15-12-6-10-7-14(16)17-13(10)8-11(12)9-4-2-1-3-5-9/h6,8-9H,1-5,7H2 |
| InChIKey | FFPGKSCPXZYKFO-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.028°C at 760 mmHg (Cal.) |
| Flash point | 197.167°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Clofurac |