|
CAS#: 61002-53-7 Product: (2,6-Dichlorophenyl) (4-Hydroxyphenyl) Ketone No suppilers available for the product. |
| Name | (2,6-Dichlorophenyl) (4-Hydroxyphenyl) Ketone |
|---|---|
| Synonyms | (2,6-Dichlorophenyl) (4-Hydroxyphenyl) Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8Cl2O2 |
| Molecular Weight | 267.11 |
| CAS Registry Number | 61002-53-7 |
| EINECS | 262-555-7 |
| SMILES | C2=C(C(C1=C(Cl)C=CC=C1Cl)=O)C=CC(=C2)O |
| InChI | 1S/C13H8Cl2O2/c14-10-2-1-3-11(15)12(10)13(17)8-4-6-9(16)7-5-8/h1-7,16H |
| InChIKey | MLWKCPQXHJATBQ-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.741°C at 760 mmHg (Cal.) |
| Flash point | 215.514°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,6-Dichlorophenyl) (4-Hydroxyphenyl) Ketone |