|
CAS#: 61000-04-2 Product: 1,3-Bis(4-Methoxyphenyl)-2-Buten-1-One No suppilers available for the product. |
| Name | 1,3-Bis(4-Methoxyphenyl)-2-Buten-1-One |
|---|---|
| Synonyms | CBMicro_011239; ZINC04268036 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33 |
| CAS Registry Number | 61000-04-2 |
| SMILES | O=C(c1ccc(OC)cc1)C=C(c2ccc(OC)cc2)C |
| InChI | 1S/C18H18O3/c1-13(14-4-8-16(20-2)9-5-14)12-18(19)15-6-10-17(21-3)11-7-15/h4-12H,1-3H3 |
| InChIKey | WGRIEPVIFFQACJ-UHFFFAOYSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.462°C at 760 mmHg (Cal.) |
| Flash point | 214.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(4-Methoxyphenyl)-2-Buten-1-One |