|
CAS#: 6101-31-1 Product: 4-Aminobenzenesulphonamide Hydrochloride No suppilers available for the product. |
| Name | 4-Aminobenzenesulphonamide Hydrochloride |
|---|---|
| Synonyms | Sulfanilamide Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9ClN2O2S |
| Molecular Weight | 208.66 |
| CAS Registry Number | 6101-31-1 |
| SMILES | [H+].C1=C([S](=O)(=O)N)C=CC(=C1)N.[Cl-] |
| InChI | 1S/C6H8N2O2S.ClH/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,7H2,(H2,8,9,10);1H |
| InChIKey | XZMIAZCXISFPEJ-UHFFFAOYSA-N |
| Boiling point | 400.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Aminobenzenesulphonamide Hydrochloride |