|
CAS#: 61100-67-2 Product: 4-Chloro-3-Hydrazinylbenzoic acid No suppilers available for the product. |
| Name | 4-Chloro-3-Hydrazinylbenzoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClN2O2 |
| Molecular Weight | 185.59 |
| CAS Registry Number | 61100-67-2 |
| SMILES | C1=C(NN)C(=CC=C1C([O-])=O)Cl |
| InChI | 1S/C7H7ClN2O2/c8-5-2-1-4(7(11)12)3-6(5)10-9/h1-3,10H,9H2,(H,11,12)/p-1 |
| InChIKey | VRJBLCRWLBHWBJ-UHFFFAOYSA-M |
| Boiling point | 378.911°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 182.959°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-3-Hydrazinylbenzoic acid |